CAS 145980-59-2 appears in our catalog under these names: 2-Methoxy-4-(trifluoromethyl)benzenesulfonyl chloride, 98%, 2-Methoxy-4-(trifluoromethyl)benzenesulfonyl chloride, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-methoxy-4-(trifluoromethyl)benzenesulfonyl chloride (CAS 145980-59-2) is a chemical compound with the molecular formula C8H6ClF3O3S and a molecular weight of 274.65 g/mol. IUPAC name: 2-methoxy-4-(trifluoromethyl)benzenesulfonyl chloride. InChIKey: ZFTUAGLVBMETPF-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O3S |
|---|---|
| Molecular weight | 274.65 g/mol |
| IUPAC name | 2-methoxy-4-(trifluoromethyl)benzenesulfonyl chloride |
| InChIKey | ZFTUAGLVBMETPF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(F)(F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)