CAS 1446016-75-6 appears in our catalog under these names: 4-Chloro-2-methylphenyl triflate, 95%, 4-Chloro-2-methylphenyl trifluoromethanesulphonate, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
(4-chloro-2-methylphenyl) trifluoromethanesulfonate (CAS 1446016-75-6) is a chemical compound with the molecular formula C8H6ClF3O3S and a molecular weight of 274.65 g/mol. IUPAC name: (4-chloro-2-methylphenyl) trifluoromethanesulfonate. InChIKey: GECYAQNQPGLIHX-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O3S |
|---|---|
| Molecular weight | 274.65 g/mol |
| IUPAC name | (4-chloro-2-methylphenyl) trifluoromethanesulfonate |
| InChIKey | GECYAQNQPGLIHX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)