Products 1132079-01-6
CAS 1132079-01-6 appears in our catalog under these names: Ivabradine Impurity 25 HCl, Ivabradine Impurity 84. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(7S)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methanamine;hydrochloride (CAS 1132079-01-6) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: [(7S)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methanamine;hydrochloride. InChIKey: UWGJJMDXKWGAED-DDWIOCJRSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | [(7S)-3,4-dimethoxy-7-bicyclo[4.2.0]octa-1,3,5-trienyl]methanamine;hydrochloride |
| InChIKey | UWGJJMDXKWGAED-DDWIOCJRSA-N |
| SMILES | COC1=C(C=C2[C@H](CC2=C1)CN)OC.Cl |
Computed by PubChem (NCBI)