Products 1132681-23-2
CAS 1132681-23-2 appears in our catalog under these names: Nicorandil-d4, Nicorandil-d4, >95% (HPLC), Nicorandil-d4 (pyridyl-d4), 98 atom % D, min 98% Chemical Purity, Nicorandil–d4, Nicorandil-d4, 99.81%. Offered by: Chemat Brand, TRC, CDN, GLPBio, TargetMol. Available pack sizes: on request, 10mg, 2,5mg, 0,05g, 0,01g, 1mg, 5mg, 5 mg.
2-[(2,4,5,6-tetradeuteriopyridine-3-carbonyl)amino]ethyl nitrate (CAS 1132681-23-2) is a chemical compound with the molecular formula C8H9N3O4 and a molecular weight of 215.20 g/mol. IUPAC name: 2-[(2,4,5,6-tetradeuteriopyridine-3-carbonyl)amino]ethyl nitrate. InChIKey: LBHIOVVIQHSOQN-VTBMLFEUSA-N.
| Molecular formula | C8H9N3O4 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-[(2,4,5,6-tetradeuteriopyridine-3-carbonyl)amino]ethyl nitrate |
| InChIKey | LBHIOVVIQHSOQN-VTBMLFEUSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C(=O)NCCO[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)