CAS 36304-45-7 is the registry number for 2-(3-Nitrophenoxy)acetohydrazide, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
2-(3-nitrophenoxy)acetohydrazide (CAS 36304-45-7) is a chemical compound with the molecular formula C8H9N3O4 and a molecular weight of 211.17 g/mol. IUPAC name: 2-(3-nitrophenoxy)acetohydrazide. InChIKey: SPNCFJGYYJIXCB-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O4 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 2-(3-nitrophenoxy)acetohydrazide |
| InChIKey | SPNCFJGYYJIXCB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)NN)[N+](=O)[O-] |
Computed by PubChem (NCBI)