CAS 54226-23-2 is the registry number for Methyl 3,4-diamino-5-nitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Methyl 3,4-diamino-5-nitrobenzoate (CAS 54226-23-2) is a chemical compound with the molecular formula C8H9N3O4 and a molecular weight of 211.17 g/mol. IUPAC name: methyl 3,4-diamino-5-nitrobenzoate. InChIKey: PQPLMBAXAXYLST-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O4 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | methyl 3,4-diamino-5-nitrobenzoate |
| InChIKey | PQPLMBAXAXYLST-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)[N+](=O)[O-])N)N |
Computed by PubChem (NCBI)