CAS 211915-52-5 is the registry number for Methyl 6-(methylamino)-5-nitronicotinate, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 6-(methylamino)-5-nitropyridine-3-carboxylate (CAS 211915-52-5) is a chemical compound with the molecular formula C8H9N3O4 and a molecular weight of 211.17 g/mol. IUPAC name: methyl 6-(methylamino)-5-nitropyridine-3-carboxylate. InChIKey: SKQONNBJDANXBF-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O4 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | methyl 6-(methylamino)-5-nitropyridine-3-carboxylate |
| InChIKey | SKQONNBJDANXBF-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=N1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)