CAS 1803593-34-1 appears in our catalog under these names: methyl 2-(methylamino)-3-nitropyridine-4-carboxylate, 95%, Methyl 2-(methylamino)-3-nitropyridine-4-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
Methyl 2-(methylamino)-3-nitropyridine-4-carboxylate (CAS 1803593-34-1) is a chemical compound with the molecular formula C8H9N3O4 and a molecular weight of 211.17 g/mol. IUPAC name: methyl 2-(methylamino)-3-nitropyridine-4-carboxylate. InChIKey: NAWYTNCUYRWLFP-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O4 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | methyl 2-(methylamino)-3-nitropyridine-4-carboxylate |
| InChIKey | NAWYTNCUYRWLFP-UHFFFAOYSA-N |
| SMILES | CNC1=NC=CC(=C1[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)