CAS 857599-45-2 appears in our catalog under these names: 2-Methoxy-4-nitro-benzoic acid hydrazide, 98%, 2-Methoxy-4-nitro-benzoic acid hydrazide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-methoxy-4-nitrobenzohydrazide (CAS 857599-45-2) is a chemical compound with the molecular formula C8H9N3O4 and a molecular weight of 211.17 g/mol. IUPAC name: 2-methoxy-4-nitrobenzohydrazide. InChIKey: FQSLOETYYLZEGJ-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O4 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 2-methoxy-4-nitrobenzohydrazide |
| InChIKey | FQSLOETYYLZEGJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)[N+](=O)[O-])C(=O)NN |
Computed by PubChem (NCBI)