CAS 75129-74-7 appears in our catalog under these names: 4-Nitrophenoxyacetic acid hydrazide, 98%, 2-(4-Nitrophenoxy)acetohydrazide, 98%, 2-(4-Nitrophenoxy)acetohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 100g, 1g, 5g, 1000mg, 2000mg, 5000mg, 10000mg.
2-(4-nitrophenoxy)acetohydrazide (CAS 75129-74-7) is a chemical compound with the molecular formula C8H9N3O4 and a molecular weight of 211.17 g/mol. IUPAC name: 2-(4-nitrophenoxy)acetohydrazide. InChIKey: BDPKZWIKLVUGKS-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O4 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 2-(4-nitrophenoxy)acetohydrazide |
| InChIKey | BDPKZWIKLVUGKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCC(=O)NN |
Computed by PubChem (NCBI)