Products 1132746-94-1
CAS 1132746-94-1 appears in our catalog under these names: Lamotrigine–d3, Lamotrigine-d3 (2,3-dichlorophenyl-d3), 98 atom % D, min 98% Chemical Purity, Lamotrigine-d3, 98.93%. Offered by: GLPBio, CDN, MedChemExpress. Available pack sizes: 1mg, 0,01g, 0,005g, 5mg, 1 mg.
6-(2,3-dichloro-4,5,6-trideuteriophenyl)-1,2,4-triazine-3,5-diamine (CAS 1132746-94-1) is a chemical compound with the molecular formula C9H7Cl2N5 and a molecular weight of 259.11 g/mol. IUPAC name: 6-(2,3-dichloro-4,5,6-trideuteriophenyl)-1,2,4-triazine-3,5-diamine. InChIKey: PYZRQGJRPPTADH-CBYSEHNBSA-N.
| Molecular formula | C9H7Cl2N5 |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | 6-(2,3-dichloro-4,5,6-trideuteriophenyl)-1,2,4-triazine-3,5-diamine |
| InChIKey | PYZRQGJRPPTADH-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])Cl)Cl)C2=C(N=C(N=N2)N)N)[2H] |
Computed by PubChem (NCBI)