CAS 94213-23-7 appears in our catalog under these names: Lamotrigine EP Impurity C, Lamotrigine Impurity C, (2Z)-2-(Cyano(2,3-dichlorophenyl)methylene)hydrazinecarboximidamide, 2-(2,3-Dichlorophenyl)-2-(guanidinoimino) acetonitrile. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 50mg, 25mg, 100mg, 2g, 1g, 5g.
(1Z)-2,3-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide (CAS 94213-23-7) is a chemical compound with the molecular formula C9H7Cl2N5 and a molecular weight of 256.09 g/mol. IUPAC name: (1Z)-2,3-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide. InChIKey: BXDSJOGMJUKSAE-VIZOYTHASA-N.
| Molecular formula | C9H7Cl2N5 |
|---|---|
| Molecular weight | 256.09 g/mol |
| IUPAC name | (1Z)-2,3-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide |
| InChIKey | BXDSJOGMJUKSAE-VIZOYTHASA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)/C(=N/N=C(N)N)/C#N |
Computed by PubChem (NCBI)