Products 94266-27-0

CAS 94266-27-0 is the registry number for Lamotrigine Impurity 9. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide (CAS 94266-27-0) is a chemical compound with the molecular formula C9H7Cl2N5 and a molecular weight of 256.09 g/mol. IUPAC name: 2,4-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide. InChIKey: CKIGTEMDGSRWLP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7Cl2N5
Molecular weight256.09 g/mol
IUPAC name2,4-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide
InChIKeyCKIGTEMDGSRWLP-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Cl)Cl)C(=NN=C(N)N)C#N

Computed by PubChem (NCBI)