CAS 94266-27-0 is the registry number for Lamotrigine Impurity 9. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2,4-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide (CAS 94266-27-0) is a chemical compound with the molecular formula C9H7Cl2N5 and a molecular weight of 256.09 g/mol. IUPAC name: 2,4-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide. InChIKey: CKIGTEMDGSRWLP-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N5 |
|---|---|
| Molecular weight | 256.09 g/mol |
| IUPAC name | 2,4-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide |
| InChIKey | CKIGTEMDGSRWLP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=NN=C(N)N)C#N |
Computed by PubChem (NCBI)