CAS 84689-20-3 appears in our catalog under these names: Lamotrigine EP Impurity B and Lamotrigine EP Impurity C, 2-(2,3-Dichlorphenyl)-2-(guanidinylimino)acetonitrile, >95% (HPLC), 2-(2,3-Dichlorophenyl)-2-guanidinyliminoacetonitrile. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 1g, 250mg, 100g, 50g.
2,3-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide (CAS 84689-20-3) is a chemical compound with the molecular formula C9H7Cl2N5 and a molecular weight of 256.09 g/mol. IUPAC name: 2,3-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide. InChIKey: BXDSJOGMJUKSAE-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N5 |
|---|---|
| Molecular weight | 256.09 g/mol |
| IUPAC name | 2,3-dichloro-N-(diaminomethylideneamino)benzenecarboximidoyl cyanide |
| InChIKey | BXDSJOGMJUKSAE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=NN=C(N)N)C#N |
Computed by PubChem (NCBI)