CAS 1246815-13-3 appears in our catalog under these names: Lamotrigine-13C3,d3, Lamotrigine-13C3,d3, Major, >95% (HPLC), Lamotrigine–13C3,d3. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
6-(2,3-dichloro-4,5,6-trideuteriophenyl)-(3,5,6-13C3)1,2,4-triazine-3,5-diamine (CAS 1246815-13-3) is a chemical compound with the molecular formula C9H7Cl2N5 and a molecular weight of 262.09 g/mol. IUPAC name: 6-(2,3-dichloro-4,5,6-trideuteriophenyl)-(3,5,6-13C3)1,2,4-triazine-3,5-diamine. InChIKey: PYZRQGJRPPTADH-MKOZQUTQSA-N.
| Molecular formula | C9H7Cl2N5 |
|---|---|
| Molecular weight | 262.09 g/mol |
| IUPAC name | 6-(2,3-dichloro-4,5,6-trideuteriophenyl)-(3,5,6-13C3)1,2,4-triazine-3,5-diamine |
| InChIKey | PYZRQGJRPPTADH-MKOZQUTQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])Cl)Cl)[13C]2=[13C](N=[13C](N=N2)N)N)[2H] |
Computed by PubChem (NCBI)