Products 2483830-10-8
CAS 2483830-10-8 is the registry number for Lamotrigine-13C2,15N. Offered by: MedChemExpress. Available pack sizes: 1 mg.
6-(2,3-dichlorophenyl)-(5,6-13C2)1,2,4-triazine-3,5-di(15N)amine (CAS 2483830-10-8) is a chemical compound with the molecular formula C9H7Cl2N5 and a molecular weight of 259.07 g/mol. IUPAC name: 6-(2,3-dichlorophenyl)-(5,6-13C2)1,2,4-triazine-3,5-di(15N)amine. InChIKey: PYZRQGJRPPTADH-CTYYVGBOSA-N.
| Molecular formula | C9H7Cl2N5 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | 6-(2,3-dichlorophenyl)-(5,6-13C2)1,2,4-triazine-3,5-di(15N)amine |
| InChIKey | PYZRQGJRPPTADH-CTYYVGBOSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)[13C]2=[13C](N=C(N=N2)N)[15NH2] |
Computed by PubChem (NCBI)