Products 38943-76-9
CAS 38943-76-9 appears in our catalog under these names: 3-Dechloro-4-chloro lamotrigine, 95%, Lamotrigine EP Impurity G, 3-Dechloro-4-chloro Lamotrigine, >95% (HPLC), 6-(2,4-Dichlorophenyl)-1,2,4-triazine-3,5-diamine, 6-(2,4-Dichlorophenyl)-1,2,4-triazine-3,5-diamine, 95%, 95%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 100mg, 250mg, on request, 25mg, 50mg.
6-(2,4-dichlorophenyl)-1,2,4-triazine-3,5-diamine (CAS 38943-76-9) is a chemical compound with the molecular formula C9H7Cl2N5 and a molecular weight of 256.09 g/mol. IUPAC name: 6-(2,4-dichlorophenyl)-1,2,4-triazine-3,5-diamine. InChIKey: HHXRWOXSGOMXJV-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N5 |
|---|---|
| Molecular weight | 256.09 g/mol |
| IUPAC name | 6-(2,4-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
| InChIKey | HHXRWOXSGOMXJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=C(N=C(N=N2)N)N |
Computed by PubChem (NCBI)
Synonyms:
6-(2,4-Dichlorophenyl)-1,2,4-triazine-3,5-diamine, Lamotrigine specified impurity G [EP], As-triazine, 3,5-diamino-6-(2,4-dichlorophenyl)-, 1,2,4-Triazine-3,5-diamine, 6-(2,4-dichlorophenyl)-, LAMOTRIGINE IMPURITY G [EP IMPURITY], LAMOTRIGINE IMPURITY G (EP IMPURITY), Lamotrigine specified impurity G, 3-Dechloro-4-chloro Lamotrigine, Lamotrigine EP Impurity G, 3,5-Diamino-6-(2,4-dichlorophenyl)-1,2,4-triazine