CAS 2734778-74-4 is the registry number for 2,2-Dichloro-1-(5-methoxy-2-methylphenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2-dichloro-1-(5-methoxy-2-methylphenyl)ethanol (CAS 2734778-74-4) is a chemical compound with the molecular formula C10H12Cl2O2 and a molecular weight of 235.10 g/mol. IUPAC name: 2,2-dichloro-1-(5-methoxy-2-methylphenyl)ethanol. InChIKey: KESNTCYYHWIBSI-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2O2 |
|---|---|
| Molecular weight | 235.10 g/mol |
| IUPAC name | 2,2-dichloro-1-(5-methoxy-2-methylphenyl)ethanol |
| InChIKey | KESNTCYYHWIBSI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC)C(C(Cl)Cl)O |
Computed by PubChem (NCBI)