CAS 1134753-48-2 is the registry number for 4-Bromo-1H-Indol-6-Amine Hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
4-bromo-1H-indol-6-amine;hydrochloride (CAS 1134753-48-2) is a chemical compound with the molecular formula C8H8BrClN2 and a molecular weight of 247.52 g/mol. IUPAC name: 4-bromo-1H-indol-6-amine;hydrochloride. InChIKey: DTTBJDSXFWUXMM-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClN2 |
|---|---|
| Molecular weight | 247.52 g/mol |
| IUPAC name | 4-bromo-1H-indol-6-amine;hydrochloride |
| InChIKey | DTTBJDSXFWUXMM-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=CC(=C2)N)Br.Cl |
Computed by PubChem (NCBI)