CAS 1135283-67-8 appears in our catalog under these names: 6-Cyclopropyl-2-hydroxynicotinic acid, 95%, 6–Cyclopropyl–2–oxo–1,2–dihydropyridine–3–carboxylic acid, 6-Cyclopropyl-2-oxo-1,2-dihydro-3-pyridinecarboxylic acid, 6-Cyclopropyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid 98%, 6-Cyclopropyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 0,5g.
6-cyclopropyl-2-oxo-1H-pyridine-3-carboxylic acid (CAS 1135283-67-8) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 6-cyclopropyl-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: PZTXDGOCNORAQY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 6-cyclopropyl-2-oxo-1H-pyridine-3-carboxylic acid |
| InChIKey | PZTXDGOCNORAQY-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C(=O)N2)C(=O)O |
Computed by PubChem (NCBI)