CAS 113890-34-9 is the registry number for (2R,4R,5S)-tetrahydro-2H-pyran-2,4,5-triol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4R,5S)-oxane-2,4,5-triol (CAS 113890-34-9) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2R,4R,5S)-oxane-2,4,5-triol. InChIKey: ZVQAVWAHRUNNPG-MROZADKFSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2R,4R,5S)-oxane-2,4,5-triol |
| InChIKey | ZVQAVWAHRUNNPG-MROZADKFSA-N |
| SMILES | C1[C@H]([C@H](CO[C@H]1O)O)O |
Computed by PubChem (NCBI)