CAS 22900-10-3 appears in our catalog under these names: (2R,4S,5R)-tetrahydro-2H-pyran-2,4,5-triol, 2-Deoxy-d-riboside 95%, 2-Deoxy-β-D-erythro-pentopyranose, 95%, 95%, Tetrahydro-2H-pyran-2,4,5-triol, 95%. Offered by: Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 250mg, 1g, 5g, 10g, 25g, 100g, 100mg.
(2R,4S,5R)-oxane-2,4,5-triol (CAS 22900-10-3) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (2R,4S,5R)-oxane-2,4,5-triol. InChIKey: ZVQAVWAHRUNNPG-VPENINKCSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (2R,4S,5R)-oxane-2,4,5-triol |
| InChIKey | ZVQAVWAHRUNNPG-VPENINKCSA-N |
| SMILES | C1[C@@H]([C@@H](CO[C@H]1O)O)O |
Computed by PubChem (NCBI)