CAS 478511-68-1 is the registry number for Thyminose-d2. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
6,6-dideuteriooxane-2,4,5-triol (CAS 478511-68-1) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 136.14 g/mol. IUPAC name: 6,6-dideuteriooxane-2,4,5-triol. InChIKey: ZVQAVWAHRUNNPG-CBTSVUPCSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 136.14 g/mol |
| IUPAC name | 6,6-dideuteriooxane-2,4,5-triol |
| InChIKey | ZVQAVWAHRUNNPG-CBTSVUPCSA-N |
| SMILES | [2H]C1(C(C(CC(O1)O)O)O)[2H] |
Computed by PubChem (NCBI)