CAS 266998-43-0 is the registry number for 2-Deoxy-D-ribose-13C5, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
(4S,5R)-(2,3,4,5,6-13C5)oxane-2,4,5-triol (CAS 266998-43-0) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 139.09 g/mol. IUPAC name: (4S,5R)-(2,3,4,5,6-13C5)oxane-2,4,5-triol. InChIKey: ZVQAVWAHRUNNPG-PWIBPOKESA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 139.09 g/mol |
| IUPAC name | (4S,5R)-(2,3,4,5,6-13C5)oxane-2,4,5-triol |
| InChIKey | ZVQAVWAHRUNNPG-PWIBPOKESA-N |
| SMILES | [13CH2]1[13C@@H]([13C@@H]([13CH2]O[13CH]1O)O)O |
Computed by PubChem (NCBI)