CAS 190588-86-4 is the registry number for (4S,5R)-Oxane-2,4,5-triol, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
(4S,5R)-oxane-2,4,5-triol (CAS 190588-86-4) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 134.13 g/mol. IUPAC name: (4S,5R)-oxane-2,4,5-triol. InChIKey: ZVQAVWAHRUNNPG-PYHARJCCSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | (4S,5R)-oxane-2,4,5-triol |
| InChIKey | ZVQAVWAHRUNNPG-PYHARJCCSA-N |
| SMILES | C1[C@@H]([C@@H](COC1O)O)O |
Computed by PubChem (NCBI)