Products 478511-60-3
CAS 478511-60-3 is the registry number for Thyminose-13C-1. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(4S,5R)-(313C)oxane-2,4,5-triol (CAS 478511-60-3) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 135.12 g/mol. IUPAC name: (4S,5R)-(313C)oxane-2,4,5-triol. InChIKey: ZVQAVWAHRUNNPG-XATPVYBQSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 135.12 g/mol |
| IUPAC name | (4S,5R)-(313C)oxane-2,4,5-triol |
| InChIKey | ZVQAVWAHRUNNPG-XATPVYBQSA-N |
| SMILES | C1[C@H]([C@H]([13CH2]C(O1)O)O)O |
Computed by PubChem (NCBI)