Products 159838-86-5
CAS 159838-86-5 is the registry number for Thyminose-13C-2. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(4S,5R)-(613C)oxane-2,4,5-triol (CAS 159838-86-5) is a chemical compound with the molecular formula C5H10O4 and a molecular weight of 135.12 g/mol. IUPAC name: (4S,5R)-(613C)oxane-2,4,5-triol. InChIKey: ZVQAVWAHRUNNPG-IPJOWORCSA-N.
| Molecular formula | C5H10O4 |
|---|---|
| Molecular weight | 135.12 g/mol |
| IUPAC name | (4S,5R)-(613C)oxane-2,4,5-triol |
| InChIKey | ZVQAVWAHRUNNPG-IPJOWORCSA-N |
| SMILES | C1[C@@H]([C@@H]([13CH2]OC1O)O)O |
Computed by PubChem (NCBI)