Products 1141669-77-3
CAS 1141669-77-3 appears in our catalog under these names: 4-(2-Nitrophenyl)-1,3-thiazole-2-carboxylic acid, 95%, 4-(2-Nitrophenyl)thiazole-2-carboxylic acid, 98%, 98%, 4-(2-Nitrophenyl)thiazole-2-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-(2-nitrophenyl)-1,3-thiazole-2-carboxylic acid (CAS 1141669-77-3) is a chemical compound with the molecular formula C10H6N2O4S and a molecular weight of 250.23 g/mol. IUPAC name: 4-(2-nitrophenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: UVBAFOQPYRZYCR-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4S |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | 4-(2-nitrophenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | UVBAFOQPYRZYCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC(=N2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)