CAS 92057-32-4 appears in our catalog under these names: 2-(3-Nitrophenyl)-1,3-thiazole-4-carboxylic acid, 2-(3-Nitrophenyl)-1,3-thiazole-4-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
2-(3-nitrophenyl)-1,3-thiazole-4-carboxylic acid (CAS 92057-32-4) is a chemical compound with the molecular formula C10H6N2O4S and a molecular weight of 250.23 g/mol. IUPAC name: 2-(3-nitrophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: UBRRJFUWRWCSMN-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4S |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | 2-(3-nitrophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | UBRRJFUWRWCSMN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)