Products 185245-05-0
CAS 185245-05-0 appears in our catalog under these names: 4-(3-Nitrophenyl)thiazole-2-carboxylic acid, 95%, 4-(3-Nitrophenyl)thiazole-2-carboxylic acid, 98%, 4–(3–Nitrophenyl)thiazole–2–carboxylic Acid, 4-(3-Nitrophenyl)thiazole-2-carboxylic Acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
4-(3-nitrophenyl)-1,3-thiazole-2-carboxylic acid (CAS 185245-05-0) is a chemical compound with the molecular formula C10H6N2O4S and a molecular weight of 250.23 g/mol. IUPAC name: 4-(3-nitrophenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: FKODWVXNPSOFRQ-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4S |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | 4-(3-nitrophenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | FKODWVXNPSOFRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CSC(=N2)C(=O)O |
Computed by PubChem (NCBI)