Products 4415-05-8

CAS 4415-05-8 is the registry number for 4-(4-Nitrophenyl)thiazole-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(4-nitrophenyl)-1,3-thiazole-2-carboxylic acid (CAS 4415-05-8) is a chemical compound with the molecular formula C10H6N2O4S and a molecular weight of 250.23 g/mol. IUPAC name: 4-(4-nitrophenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: VHYQYTIXQIKLRA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6N2O4S
Molecular weight250.23 g/mol
IUPAC name4-(4-nitrophenyl)-1,3-thiazole-2-carboxylic acid
InChIKeyVHYQYTIXQIKLRA-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=CSC(=N2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)