CAS 4415-05-8 is the registry number for 4-(4-Nitrophenyl)thiazole-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(4-nitrophenyl)-1,3-thiazole-2-carboxylic acid (CAS 4415-05-8) is a chemical compound with the molecular formula C10H6N2O4S and a molecular weight of 250.23 g/mol. IUPAC name: 4-(4-nitrophenyl)-1,3-thiazole-2-carboxylic acid. InChIKey: VHYQYTIXQIKLRA-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4S |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | 4-(4-nitrophenyl)-1,3-thiazole-2-carboxylic acid |
| InChIKey | VHYQYTIXQIKLRA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC(=N2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)