CAS 185245-04-9 appears in our catalog under these names: 2-(4-Nitrophenyl)-1,3-thiazole-5-carboxylic acid, 95%, 2-(4-Nitrophenyl)-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(4-nitrophenyl)-1,3-thiazole-5-carboxylic acid (CAS 185245-04-9) is a chemical compound with the molecular formula C10H6N2O4S and a molecular weight of 250.23 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: MGZKEYFJHPBVRO-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4S |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | MGZKEYFJHPBVRO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(S2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)