CAS 766557-57-7 is the registry number for 5–(thiophen–2–yl)–(1,3)dioxolo(4,5–d)pyriMidine–7–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg.
5-thiophen-2-yl-[1,3]dioxolo[4,5-d]pyrimidine-7-carboxylic acid (CAS 766557-57-7) is a chemical compound with the molecular formula C10H6N2O4S and a molecular weight of 250.23 g/mol. IUPAC name: 5-thiophen-2-yl-[1,3]dioxolo[4,5-d]pyrimidine-7-carboxylic acid. InChIKey: MGFDVLDLQNZUBH-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4S |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | 5-thiophen-2-yl-[1,3]dioxolo[4,5-d]pyrimidine-7-carboxylic acid |
| InChIKey | MGFDVLDLQNZUBH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(N=C(N=C2O1)C3=CC=CS3)C(=O)O |
Computed by PubChem (NCBI)