Products 17228-97-6

CAS 17228-97-6 is the registry number for 2-(4-Nitrophenyl)thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-(4-nitrophenyl)-1,3-thiazole-4-carboxylic acid (CAS 17228-97-6) is a chemical compound with the molecular formula C10H6N2O4S and a molecular weight of 250.23 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: IBVCOHAMYOJGBA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6N2O4S
Molecular weight250.23 g/mol
IUPAC name2-(4-nitrophenyl)-1,3-thiazole-4-carboxylic acid
InChIKeyIBVCOHAMYOJGBA-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NC(=CS2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)