CAS 17228-97-6 is the registry number for 2-(4-Nitrophenyl)thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-(4-nitrophenyl)-1,3-thiazole-4-carboxylic acid (CAS 17228-97-6) is a chemical compound with the molecular formula C10H6N2O4S and a molecular weight of 250.23 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylic acid. InChIKey: IBVCOHAMYOJGBA-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O4S |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | IBVCOHAMYOJGBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)