CAS 1478682-01-7 appears in our catalog under these names: 1-(2,6-Dichlorophenyl)-1H-pyrrole-2-carboxylic acid, 95%, 1-(2,6-Dichlorophenyl)-1H-pyrrole-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(2,6-dichlorophenyl)pyrrole-2-carboxylic acid (CAS 1478682-01-7) is a chemical compound with the molecular formula C11H7Cl2NO2 and a molecular weight of 256.08 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)pyrrole-2-carboxylic acid. InChIKey: UEFSRFPQTPSWMF-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2NO2 |
|---|---|
| Molecular weight | 256.08 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)pyrrole-2-carboxylic acid |
| InChIKey | UEFSRFPQTPSWMF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)N2C=CC=C2C(=O)O)Cl |
Computed by PubChem (NCBI)