CAS 1142201-76-0 appears in our catalog under these names: 2-Chloro-3-(5-isopropyl-1,2,4-oxadiazol-3-yl)-6-methylquinoline, 95%, 3-(2-Chloro-6-methylquinolin-3-yl)-5-isopropyl-1,2,4-oxadiazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(2-chloro-6-methylquinolin-3-yl)-5-propan-2-yl-1,2,4-oxadiazole (CAS 1142201-76-0) is a chemical compound with the molecular formula C15H14ClN3O and a molecular weight of 287.74 g/mol. IUPAC name: 3-(2-chloro-6-methylquinolin-3-yl)-5-propan-2-yl-1,2,4-oxadiazole. InChIKey: VIHRPERXAGGJDX-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3O |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | 3-(2-chloro-6-methylquinolin-3-yl)-5-propan-2-yl-1,2,4-oxadiazole |
| InChIKey | VIHRPERXAGGJDX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=C(N=C2C=C1)Cl)C3=NOC(=N3)C(C)C |
Computed by PubChem (NCBI)