CAS 22126-93-8 is the registry number for 2-(Aminomethyl)-3-phenyl-4(3H)-quinazolinone. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
2-(aminomethyl)-3-phenylquinazolin-4-one;hydrochloride (CAS 22126-93-8) is a chemical compound with the molecular formula C15H14ClN3O and a molecular weight of 287.74 g/mol. IUPAC name: 2-(aminomethyl)-3-phenylquinazolin-4-one;hydrochloride. InChIKey: JDYWMPWVDXPAQB-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3O |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | 2-(aminomethyl)-3-phenylquinazolin-4-one;hydrochloride |
| InChIKey | JDYWMPWVDXPAQB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NC3=CC=CC=C3C2=O)CN.Cl |
Computed by PubChem (NCBI)