CAS 304456-58-4 is the registry number for N'-(1-(4-Aminophenyl)ethylidene)-3-chlorobenzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-chlorobenzamide (CAS 304456-58-4) is a chemical compound with the molecular formula C15H14ClN3O and a molecular weight of 287.74 g/mol. IUPAC name: N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-chlorobenzamide. InChIKey: QRSDLQMWWONUTR-VCHYOVAHSA-N.
| Molecular formula | C15H14ClN3O |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-3-chlorobenzamide |
| InChIKey | QRSDLQMWWONUTR-VCHYOVAHSA-N |
| SMILES | C/C(=N\NC(=O)C1=CC(=CC=C1)Cl)/C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)