CAS 27537-87-7 appears in our catalog under these names: Alprazolam EP Impurity A, Alprazolam Impurity 1(Alprazolam EP Impurity A), 3-Amino-6-chloro-3,4-dihydro-2-methyl-4-phenyl-4-quinazolinol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-amino-6-chloro-2-methyl-4-phenylquinazolin-4-ol (CAS 27537-87-7) is a chemical compound with the molecular formula C15H14ClN3O and a molecular weight of 287.74 g/mol. IUPAC name: 3-amino-6-chloro-2-methyl-4-phenylquinazolin-4-ol. InChIKey: IEQYCNKKNGEMAN-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3O |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | 3-amino-6-chloro-2-methyl-4-phenylquinazolin-4-ol |
| InChIKey | IEQYCNKKNGEMAN-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)Cl)C(N1N)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)