CAS 1609409-30-4 is the registry number for (2-[3-(3-Methylphenyl)-1,2,4-oxadiazol-5-yl]phenyl)amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline;hydrochloride (CAS 1609409-30-4) is a chemical compound with the molecular formula C15H14ClN3O and a molecular weight of 287.74 g/mol. IUPAC name: 2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline;hydrochloride. InChIKey: LLQOLEXVZAZFJG-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3O |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | 2-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]aniline;hydrochloride |
| InChIKey | LLQOLEXVZAZFJG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NOC(=N2)C3=CC=CC=C3N.Cl |
Computed by PubChem (NCBI)