CAS 1179704-79-0 is the registry number for 2-Amino-5-(7-chloro-1-ethyl-1H-1,3-benzodiazol-2-yl)phenol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-5-(7-chloro-1-ethylbenzimidazol-2-yl)phenol (CAS 1179704-79-0) is a chemical compound with the molecular formula C15H14ClN3O and a molecular weight of 287.74 g/mol. IUPAC name: 2-amino-5-(7-chloro-1-ethylbenzimidazol-2-yl)phenol. InChIKey: PHUASJIDXPTTJO-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3O |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | 2-amino-5-(7-chloro-1-ethylbenzimidazol-2-yl)phenol |
| InChIKey | PHUASJIDXPTTJO-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=CC=C2Cl)N=C1C3=CC(=C(C=C3)N)O |
Computed by PubChem (NCBI)