Products 923842-98-2
CAS 923842-98-2 is the registry number for 2-Chloro-n-(3-cyano-4,5-dimethyl-1-phenyl-1h-pyrrol-2-yl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)acetamide (CAS 923842-98-2) is a chemical compound with the molecular formula C15H14ClN3O and a molecular weight of 287.74 g/mol. IUPAC name: 2-chloro-N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)acetamide. InChIKey: UKKXCSHWORZBQM-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3O |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | 2-chloro-N-(3-cyano-4,5-dimethyl-1-phenylpyrrol-2-yl)acetamide |
| InChIKey | UKKXCSHWORZBQM-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C(=C1C#N)NC(=O)CCl)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)