Products 1144037-37-5
CAS 1144037-37-5 appears in our catalog under these names: 3,5-Dichlorobenzyl piperazine-1-carboxylate, 97%, 3,5-Dichlorobenzyl piperazine-1-carboxylate, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 100mg.
(3,5-dichlorophenyl)methyl piperazine-1-carboxylate (CAS 1144037-37-5) is a chemical compound with the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.15 g/mol. IUPAC name: (3,5-dichlorophenyl)methyl piperazine-1-carboxylate. InChIKey: RBPSRPYEBWMAGK-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O2 |
|---|---|
| Molecular weight | 289.15 g/mol |
| IUPAC name | (3,5-dichlorophenyl)methyl piperazine-1-carboxylate |
| InChIKey | RBPSRPYEBWMAGK-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)OCC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)