CAS 2108118-84-7 is the registry number for Methyl 2-amino-3-(6-chloro-1H-indol-3-yl)propanoate hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 2-amino-3-(6-chloro-1H-indol-3-yl)propanoate;hydrochloride (CAS 2108118-84-7) is a chemical compound with the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.15 g/mol. IUPAC name: methyl 2-amino-3-(6-chloro-1H-indol-3-yl)propanoate;hydrochloride. InChIKey: PIVQJJKOYKVJNE-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O2 |
|---|---|
| Molecular weight | 289.15 g/mol |
| IUPAC name | methyl 2-amino-3-(6-chloro-1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | PIVQJJKOYKVJNE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CNC2=C1C=CC(=C2)Cl)N.Cl |
Computed by PubChem (NCBI)