Products 447412-46-6
CAS 447412-46-6 is the registry number for 3-(Aminomethyl)-6-chloro-4-methoxy-2-methylisoquinolin-1(2H)-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(aminomethyl)-6-chloro-4-methoxy-2-methylisoquinolin-1-one;hydrochloride (CAS 447412-46-6) is a chemical compound with the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.15 g/mol. IUPAC name: 3-(aminomethyl)-6-chloro-4-methoxy-2-methylisoquinolin-1-one;hydrochloride. InChIKey: OPOKJRXQDKCDQY-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O2 |
|---|---|
| Molecular weight | 289.15 g/mol |
| IUPAC name | 3-(aminomethyl)-6-chloro-4-methoxy-2-methylisoquinolin-1-one;hydrochloride |
| InChIKey | OPOKJRXQDKCDQY-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C2=C(C1=O)C=CC(=C2)Cl)OC)CN.Cl |
Computed by PubChem (NCBI)