CAS 1155560-08-9 is the registry number for 1-Cyclopropyl-3-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)urea, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-cyclopropyl-3-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)urea (CAS 1155560-08-9) is a chemical compound with the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.15 g/mol. IUPAC name: 1-cyclopropyl-3-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)urea. InChIKey: KZFRSQJJKDENGT-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O2 |
|---|---|
| Molecular weight | 289.15 g/mol |
| IUPAC name | 1-cyclopropyl-3-(2,5-dichlorophenyl)-1-(2-hydroxyethyl)urea |
| InChIKey | KZFRSQJJKDENGT-UHFFFAOYSA-N |
| SMILES | C1CC1N(CCO)C(=O)NC2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)