Products 85732-39-4
CAS 85732-39-4 appears in our catalog under these names: 6-Chloro-1,2-dihydrospiro[3,1-benzoxazine-4,4'-piperidine]-2-one hydrochloride, 95%, 6-Chlorospiro(benzo(d)(1,3)oxazine-4,4'-piperidin)-2(1H)-one hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
6-chlorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride (CAS 85732-39-4) is a chemical compound with the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.15 g/mol. IUPAC name: 6-chlorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride. InChIKey: ZHSLOGOHAKCUNZ-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O2 |
|---|---|
| Molecular weight | 289.15 g/mol |
| IUPAC name | 6-chlorospiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride |
| InChIKey | ZHSLOGOHAKCUNZ-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=CC(=C3)Cl)NC(=O)O2.Cl |
Computed by PubChem (NCBI)