Products 2253638-81-0

CAS 2253638-81-0 is the registry number for 2-Amino-3-(quinolin-3-yl)propanoic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-3-quinolin-3-ylpropanoic acid;dihydrochloride (CAS 2253638-81-0) is a chemical compound with the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.15 g/mol. IUPAC name: 2-amino-3-quinolin-3-ylpropanoic acid;dihydrochloride. InChIKey: MVPDMDQKBTYUDG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14Cl2N2O2
Molecular weight289.15 g/mol
IUPAC name2-amino-3-quinolin-3-ylpropanoic acid;dihydrochloride
InChIKeyMVPDMDQKBTYUDG-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=C(C=N2)CC(C(=O)O)N.Cl.Cl

Computed by PubChem (NCBI)