Products 1821026-93-0
CAS 1821026-93-0 is the registry number for (R)-6-Chlorospiro[benzo[d][1,3]oxazine-4,3'-piperidin]-2(1H)-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-6-chlorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one;hydrochloride (CAS 1821026-93-0) is a chemical compound with the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.15 g/mol. IUPAC name: (4R)-6-chlorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one;hydrochloride. InChIKey: ZHGSLDSUZYFJSE-YDALLXLXSA-N.
| Molecular formula | C12H14Cl2N2O2 |
|---|---|
| Molecular weight | 289.15 g/mol |
| IUPAC name | (4R)-6-chlorospiro[1H-3,1-benzoxazine-4,3'-piperidine]-2-one;hydrochloride |
| InChIKey | ZHGSLDSUZYFJSE-YDALLXLXSA-N |
| SMILES | C1C[C@]2(CNC1)C3=C(C=CC(=C3)Cl)NC(=O)O2.Cl |
Computed by PubChem (NCBI)