CAS 114483-24-8 is the registry number for 4,4'-(Naphthalene-1,5-diyl)dianiline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[5-(4-aminophenyl)naphthalen-1-yl]aniline (CAS 114483-24-8) is a chemical compound with the molecular formula C22H18N2 and a molecular weight of 310.4 g/mol. IUPAC name: 4-[5-(4-aminophenyl)naphthalen-1-yl]aniline. InChIKey: JTAINYGMOZTPMD-UHFFFAOYSA-N.
| Molecular formula | C22H18N2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 4-[5-(4-aminophenyl)naphthalen-1-yl]aniline |
| InChIKey | JTAINYGMOZTPMD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2C3=CC=C(C=C3)N)C(=C1)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)